About (2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride
(2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride (PubChem CID 23076591) has the molecular formula C24H23ClNOP
and a molecular weight of 407.88 g/mol. Its IUPAC name is (2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride.
Molecular Properties
| Compound Name | (2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride |
| PubChem CID | 23076591 |
| Molecular Formula | C24H23ClNOP |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | (2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride |
| SMILES | CCc1nc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)co1.[Cl-] |
| InChI | InChI=1S/C24H23NOP.ClH/c1-2-24-25-20(18-26-24)19-27(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23;/h3-18H,2,19H2,1H3;1H/q+1;/p-1 |
| InChIKey | ZFULWBRTIOOAFM-UHFFFAOYSA-M |
| XLogP | 1.74 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride?
The IUPAC name of (2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride (CID 23076591) is (2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride.
What is the SMILES notation for (2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride?
The canonical SMILES for (2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride is CCc1nc(C[P+](c2ccccc2)(c2ccccc2)c2ccccc2)co1.[Cl-].
What is the InChIKey of (2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride?
The InChIKey is ZFULWBRTIOOAFM-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H23NOP.ClH/c1-2-24-25-20(18-26-24)19-27(21-12-6-3-7-13-21,22-14-8-4-9-15-22)23-16-10-5-11-17-23;/h3-18H,2,19H2,1H3;1H/q+1;/p-1.
What are the key properties of (2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride?
(2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride has a molecular weight of 407.88 g/mol, XLogP of 1.74, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-1,3-oxazol-4-yl)methyl-triphenylphosphanium chloride is sourced from PubChem (CID 23076591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).