C8H12N4O — CID 23076672
2-azido-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one (PubChem CID 23076672) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-azido-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one.
| Compound Name | 2-azido-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one |
|---|---|
| PubChem CID | 23076672 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2-azido-2,3,5,6,8,8a-hexahydro-1H-indolizin-7-one |
| SMILES | [N-]=[N+]=NC1CC2CC(=O)CCN2C1 |
| InChI | InChI=1S/C8H12N4O/c9-11-10-6-3-7-4-8(13)1-2-12(7)5-6/h6-7H,1-5H2 |
| InChIKey | OZXOFHJKUYIHIP-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|