About 4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde
4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde (PubChem CID 23077151) has the molecular formula C5H6N2O2S
and a molecular weight of 158.18 g/mol. Its IUPAC name is 4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde.
Molecular Properties
| Compound Name | 4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde |
| PubChem CID | 23077151 |
| Molecular Formula | C5H6N2O2S |
| Molecular Weight | 158.18 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | 4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde |
| SMILES | CC1(C=S)NC(=O)NC1=O |
| InChI | InChI=1S/C5H6N2O2S/c1-5(2-10)3(8)6-4(9)7-5/h2H,1H3,(H2,6,7,8,9) |
| InChIKey | XBANFUMPRRKREV-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.18 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde?
The IUPAC name of 4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde (CID 23077151) is 4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde.
What is the SMILES notation for 4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde?
The canonical SMILES for 4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde is CC1(C=S)NC(=O)NC1=O.
What is the InChIKey of 4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde?
The InChIKey is XBANFUMPRRKREV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2S/c1-5(2-10)3(8)6-4(9)7-5/h2H,1H3,(H2,6,7,8,9).
What are the key properties of 4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde?
4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde has a molecular weight of 158.18 g/mol, XLogP of -0.42, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,5-dioxoimidazolidine-4-carbothialdehyde is sourced from PubChem (CID 23077151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).