About methyl carbonate;1,2,3-trimethylimidazol-1-ium
methyl carbonate;1,2,3-trimethylimidazol-1-ium (PubChem CID 23077197) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl carbonate;1,2,3-trimethylimidazol-1-ium.
Molecular Properties
| Compound Name | methyl carbonate;1,2,3-trimethylimidazol-1-ium |
| PubChem CID | 23077197 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | methyl carbonate;1,2,3-trimethylimidazol-1-ium |
| SMILES | COC(=O)[O-].Cc1n(C)cc[n+]1C |
| InChI | InChI=1S/C6H11N2.C2H4O3/c1-6-7(2)4-5-8(6)3;1-5-2(3)4/h4-5H,1-3H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | PHHNJCDHQMZYGC-UHFFFAOYSA-M |
| XLogP | -0.87 |
| TPSA | 58.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl carbonate;1,2,3-trimethylimidazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl carbonate;1,2,3-trimethylimidazol-1-ium?
The IUPAC name of methyl carbonate;1,2,3-trimethylimidazol-1-ium (CID 23077197) is methyl carbonate;1,2,3-trimethylimidazol-1-ium.
What is the SMILES notation for methyl carbonate;1,2,3-trimethylimidazol-1-ium?
The canonical SMILES for methyl carbonate;1,2,3-trimethylimidazol-1-ium is COC(=O)[O-].Cc1n(C)cc[n+]1C.
What is the InChIKey of methyl carbonate;1,2,3-trimethylimidazol-1-ium?
The InChIKey is PHHNJCDHQMZYGC-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H11N2.C2H4O3/c1-6-7(2)4-5-8(6)3;1-5-2(3)4/h4-5H,1-3H3;1H3,(H,3,4)/q+1;/p-1.
What are the key properties of methyl carbonate;1,2,3-trimethylimidazol-1-ium?
methyl carbonate;1,2,3-trimethylimidazol-1-ium has a molecular weight of 186.21 g/mol, XLogP of -0.87, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl carbonate;1,2,3-trimethylimidazol-1-ium is sourced from PubChem (CID 23077197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).