C13H26N2 — CID 23077207
1,2,3,4,5-pentaethyl-2H-imidazole (PubChem CID 23077207) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 1,2,3,4,5-pentaethyl-2H-imidazole.
| Compound Name | 1,2,3,4,5-pentaethyl-2H-imidazole |
|---|---|
| PubChem CID | 23077207 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1,2,3,4,5-pentaethyl-2H-imidazole |
| SMILES | CCC1=C(CC)N(CC)C(CC)N1CC |
| InChI | InChI=1S/C13H26N2/c1-6-11-12(7-2)15(10-5)13(8-3)14(11)9-4/h13H,6-10H2,1-5H3 |
| InChIKey | LVRJNGYETXZYCX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |