C12H11F12N — CID 23077287
2-cyclohexyl-2,3,3,4,4,5,5,6,6-nonafluoro-1-(trifluoromethyl)piperidine (PubChem CID 23077287) has the molecular formula C12H11F12N and a molecular weight of 397.20 g/mol. Its IUPAC name is 2-cyclohexyl-2,3,3,4,4,5,5,6,6-nonafluoro-1-(trifluoromethyl)piperidine.
| Compound Name | 2-cyclohexyl-2,3,3,4,4,5,5,6,6-nonafluoro-1-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 23077287 |
| Molecular Formula | C12H11F12N |
| Molecular Weight | 397.20 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 2-cyclohexyl-2,3,3,4,4,5,5,6,6-nonafluoro-1-(trifluoromethyl)piperidine |
| SMILES | FC(F)(F)N1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)C1CCCCC1 |
| InChI | InChI=1S/C12H11F12N/c13-7(6-4-2-1-3-5-6)8(14,15)9(16,17)10(18,19)11(20,21)25(7)12(22,23)24/h6H,1-5H2 |
| InChIKey | BQWBPKFAABSYJO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.20 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|