C33H33NO6 — CID 23079111
2-[4-[[3-phenylpropyl-(3,4,5-trimethoxybenzoyl)amino]methyl]phenyl]benzoic acid (PubChem CID 23079111) has the molecular formula C33H33NO6 and a molecular weight of 539.63 g/mol. Its IUPAC name is 2-[4-[[3-phenylpropyl-(3,4,5-trimethoxybenzoyl)amino]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[3-phenylpropyl-(3,4,5-trimethoxybenzoyl)amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 23079111 |
| Molecular Formula | C33H33NO6 |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.23 |
| IUPAC Name | 2-[4-[[3-phenylpropyl-(3,4,5-trimethoxybenzoyl)amino]methyl]phenyl]benzoic acid |
| SMILES | COc1cc(C(=O)N(CCCc2ccccc2)Cc2ccc(-c3ccccc3C(=O)O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C33H33NO6/c1-38-29-20-26(21-30(39-2)31(29)40-3)32(35)34(19-9-12-23-10-5-4-6-11-23)22-24-15-17-25(18-16-24)27-13-7-8-14-28(27)33(36)37/h4-8,10-11,13-18,20-21H,9,12,19,22H2,1-3H3,(H,36,37) |
| InChIKey | PFMLIISTMNNEBF-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |