2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid

C7H8N2O4 — CID 23079148

IUPAC2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid
SMILESO=C(O)NCCN1C(=O)C=CC1=O
InChIInChI=1S/C7H8N2O4/c10-5-1-2-6(11)9(5)4-3-8-7(12)13/h1-2,8H,3-4H2,(H,12,13)
InChIKeyRGBFGCSTAMHTKM-UHFFFAOYSA-N
MW184.15 g/mol
LogP-0.82
Rot. Bonds3

About 2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid

2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid (PubChem CID 23079148) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid.

Molecular Properties

Compound Name2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid
PubChem CID23079148
Molecular FormulaC7H8N2O4
Molecular Weight184.15 g/mol
Exact Mass184.05
IUPAC Name2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid
SMILESO=C(O)NCCN1C(=O)C=CC1=O
InChIInChI=1S/C7H8N2O4/c10-5-1-2-6(11)9(5)4-3-8-7(12)13/h1-2,8H,3-4H2,(H,12,13)
InChIKeyRGBFGCSTAMHTKM-UHFFFAOYSA-N
XLogP-0.82
TPSA86.71 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.15
LogP ≤ 5-0.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid?
The IUPAC name of 2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid (CID 23079148) is 2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid.
What is the SMILES notation for 2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid?
The canonical SMILES for 2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid is O=C(O)NCCN1C(=O)C=CC1=O.
What is the InChIKey of 2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid?
The InChIKey is RGBFGCSTAMHTKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O4/c10-5-1-2-6(11)9(5)4-3-8-7(12)13/h1-2,8H,3-4H2,(H,12,13).
What are the key properties of 2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid?
2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid has a molecular weight of 184.15 g/mol, XLogP of -0.82, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dioxopyrrol-1-yl)ethylcarbamic acid is sourced from PubChem (CID 23079148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).