C13H18N2O5 — CID 23079593
6-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid (PubChem CID 23079593) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 6-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid.
| Compound Name | 6-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 23079593 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 6-[2-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoic acid |
| SMILES | CC(C(=O)NCCCCCC(=O)O)N1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H18N2O5/c1-9(15-10(16)6-7-11(15)17)13(20)14-8-4-2-3-5-12(18)19/h6-7,9H,2-5,8H2,1H3,(H,14,20)(H,18,19) |
| InChIKey | HSTJNAQYZIPMGT-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|