About 2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride
2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride (PubChem CID 23079677) has the molecular formula C11H21ClF2N2O
and a molecular weight of 270.75 g/mol. Its IUPAC name is 2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride |
| PubChem CID | 23079677 |
| Molecular Formula | C11H21ClF2N2O |
| Molecular Weight | 270.75 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride |
| SMILES | Cl.FC1(F)CCN(CCC2CNCCO2)CC1 |
| InChI | InChI=1S/C11H20F2N2O.ClH/c12-11(13)2-6-15(7-3-11)5-1-10-9-14-4-8-16-10;/h10,14H,1-9H2;1H |
| InChIKey | BUJQJJHOUNJATK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.75 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride?
The IUPAC name of 2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride (CID 23079677) is 2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride.
What is the SMILES notation for 2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride?
The canonical SMILES for 2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride is Cl.FC1(F)CCN(CCC2CNCCO2)CC1.
What is the InChIKey of 2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride?
The InChIKey is BUJQJJHOUNJATK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N2O.ClH/c12-11(13)2-6-15(7-3-11)5-1-10-9-14-4-8-16-10;/h10,14H,1-9H2;1H.
What are the key properties of 2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride?
2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride has a molecular weight of 270.75 g/mol, XLogP of 1.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4,4-difluoropiperidin-1-yl)ethyl]morpholine;hydrochloride is sourced from PubChem (CID 23079677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).