C17H18N2 — CID 23079916
4-(2,2-dimethylpyrrolidin-1-yl)naphthalene-1-carbonitrile (PubChem CID 23079916) has the molecular formula C17H18N2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 4-(2,2-dimethylpyrrolidin-1-yl)naphthalene-1-carbonitrile.
| Compound Name | 4-(2,2-dimethylpyrrolidin-1-yl)naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 23079916 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 4-(2,2-dimethylpyrrolidin-1-yl)naphthalene-1-carbonitrile |
| SMILES | CC1(C)CCCN1c1ccc(C#N)c2ccccc12 |
| InChI | InChI=1S/C17H18N2/c1-17(2)10-5-11-19(17)16-9-8-13(12-18)14-6-3-4-7-15(14)16/h3-4,6-9H,5,10-11H2,1-2H3 |
| InChIKey | JFOQAQUJROWDKY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |