About (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol
(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol (PubChem CID 23081240) has the molecular formula C7H9N3O4
and a molecular weight of 199.17 g/mol. Its IUPAC name is (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol.
Molecular Properties
| Compound Name | (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol |
| PubChem CID | 23081240 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol |
| SMILES | CC1(CO)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C7H9N3O4/c1-7(4-11)3-9-2-5(10(12)13)8-6(9)14-7/h2,11H,3-4H2,1H3 |
| InChIKey | UYEAVRLFLZMBSY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol?
The IUPAC name of (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol (CID 23081240) is (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol.
What is the SMILES notation for (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol?
The canonical SMILES for (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol is CC1(CO)Cn2cc([N+](=O)[O-])nc2O1.
What is the InChIKey of (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol?
The InChIKey is UYEAVRLFLZMBSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O4/c1-7(4-11)3-9-2-5(10(12)13)8-6(9)14-7/h2,11H,3-4H2,1H3.
What are the key properties of (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol?
(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol has a molecular weight of 199.17 g/mol, XLogP of -0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methanol is sourced from PubChem (CID 23081240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).