C22H28ClN5O4 — CID 23081430
5-(4-chlorophenyl)-1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]pentan-1-one (PubChem CID 23081430) has the molecular formula C22H28ClN5O4 and a molecular weight of 461.95 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]pentan-1-one.
| Compound Name | 5-(4-chlorophenyl)-1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]pentan-1-one |
|---|---|
| PubChem CID | 23081430 |
| Molecular Formula | C22H28ClN5O4 |
| Molecular Weight | 461.95 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 5-(4-chlorophenyl)-1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]pentan-1-one |
| SMILES | CC1(CN2CCN(C(=O)CCCCc3ccc(Cl)cc3)CC2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C22H28ClN5O4/c1-22(16-27-14-19(28(30)31)24-21(27)32-22)15-25-10-12-26(13-11-25)20(29)5-3-2-4-17-6-8-18(23)9-7-17/h6-9,14H,2-5,10-13,15-16H2,1H3 |
| InChIKey | PDOCCYICOGRBFP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.95 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|