C16H18N4O3 — CID 23081431
2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 23081431) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 23081431 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | CC1(CN2CCc3ccccc3C2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C16H18N4O3/c1-16(11-19-9-14(20(21)22)17-15(19)23-16)10-18-7-6-12-4-2-3-5-13(12)8-18/h2-5,9H,6-8,10-11H2,1H3 |
| InChIKey | NTWWPBRKUWBTPH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|