C21H26ClN5O4 — CID 23081535
4-(4-chlorophenyl)-1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]butan-1-one (PubChem CID 23081535) has the molecular formula C21H26ClN5O4 and a molecular weight of 447.92 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]butan-1-one.
| Compound Name | 4-(4-chlorophenyl)-1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 23081535 |
| Molecular Formula | C21H26ClN5O4 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-(4-chlorophenyl)-1-[4-[(2-methyl-6-nitro-3H-imidazo[2,1-b][1,3]oxazol-2-yl)methyl]piperazin-1-yl]butan-1-one |
| SMILES | CC1(CN2CCN(C(=O)CCCc3ccc(Cl)cc3)CC2)Cn2cc([N+](=O)[O-])nc2O1 |
| InChI | InChI=1S/C21H26ClN5O4/c1-21(15-26-13-18(27(29)30)23-20(26)31-21)14-24-9-11-25(12-10-24)19(28)4-2-3-16-5-7-17(22)8-6-16/h5-8,13H,2-4,9-12,14-15H2,1H3 |
| InChIKey | GGRISQXYICHWDJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 93.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|