About 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate
2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate (PubChem CID 2308172) has the molecular formula C18H20NO3S+
and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate.
Molecular Properties
| Compound Name | 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate |
| PubChem CID | 2308172 |
| Molecular Formula | C18H20NO3S+ |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate |
| SMILES | Cc1c(CCOC(=O)C2CC2)sc[n+]1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20NO3S/c1-13-17(9-10-22-18(21)15-7-8-15)23-12-19(13)11-16(20)14-5-3-2-4-6-14/h2-6,12,15H,7-11H2,1H3/q+1 |
| InChIKey | CJBVRZDTRQEKAF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate?
The IUPAC name of 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate (CID 2308172) is 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate.
What is the SMILES notation for 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate?
The canonical SMILES for 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate is Cc1c(CCOC(=O)C2CC2)sc[n+]1CC(=O)c1ccccc1.
What is the InChIKey of 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate?
The InChIKey is CJBVRZDTRQEKAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20NO3S/c1-13-17(9-10-22-18(21)15-7-8-15)23-12-19(13)11-16(20)14-5-3-2-4-6-14/h2-6,12,15H,7-11H2,1H3/q+1.
What are the key properties of 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate?
2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate has a molecular weight of 330.43 g/mol, XLogP of 2.72, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-3-phenacyl-1,3-thiazol-3-ium-5-yl)ethyl cyclopropanecarboxylate is sourced from PubChem (CID 2308172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).