C36H78O8P4 — CID 23081780
1,2,3,4-tetrakis[di(butan-2-yl)phosphoryloxy]butane (PubChem CID 23081780) has the molecular formula C36H78O8P4 and a molecular weight of 762.91 g/mol. Its IUPAC name is 1,2,3,4-tetrakis[di(butan-2-yl)phosphoryloxy]butane.
| Compound Name | 1,2,3,4-tetrakis[di(butan-2-yl)phosphoryloxy]butane |
|---|---|
| PubChem CID | 23081780 |
| Molecular Formula | C36H78O8P4 |
| Molecular Weight | 762.91 g/mol |
| Exact Mass | 762.46 |
| IUPAC Name | 1,2,3,4-tetrakis[di(butan-2-yl)phosphoryloxy]butane |
| SMILES | CCC(C)P(=O)(OCC(OP(=O)(C(C)CC)C(C)CC)C(COP(=O)(C(C)CC)C(C)CC)OP(=O)(C(C)CC)C(C)CC)C(C)CC |
| InChI | InChI=1S/C36H78O8P4/c1-17-27(9)45(37,28(10)18-2)41-25-35(43-47(39,31(13)21-5)32(14)22-6)36(44-48(40,33(15)23-7)34(16)24-8)26-42-46(38,29(11)19-3)30(12)20-4/h27-36H,17-26H2,1-16H3 |
| InChIKey | ZJFRCKVQXHMMAJ-UHFFFAOYSA-N |
| XLogP | 13.29 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.91 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|