C11H26O4P2 — CID 23081880
1,3-bis(diethylphosphoryloxy)propane (PubChem CID 23081880) has the molecular formula C11H26O4P2 and a molecular weight of 284.27 g/mol. Its IUPAC name is 1,3-bis(diethylphosphoryloxy)propane.
| Compound Name | 1,3-bis(diethylphosphoryloxy)propane |
|---|---|
| PubChem CID | 23081880 |
| Molecular Formula | C11H26O4P2 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1,3-bis(diethylphosphoryloxy)propane |
| SMILES | CCP(=O)(CC)OCCCOP(=O)(CC)CC |
| InChI | InChI=1S/C11H26O4P2/c1-5-16(12,6-2)14-10-9-11-15-17(13,7-3)8-4/h5-11H2,1-4H3 |
| InChIKey | JFDQHRMXELTOSO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|