C19H20F3N7O3S2 — CID 23081895
7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-(1,3-thiazol-2-ylsulfanyl)purin-6-one;2,2,2-trifluoroacetic acid (PubChem CID 23081895) has the molecular formula C19H20F3N7O3S2 and a molecular weight of 515.54 g/mol. Its IUPAC name is 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-(1,3-thiazol-2-ylsulfanyl)purin-6-one;2,2,2-trifluoroacetic acid.
| Compound Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-(1,3-thiazol-2-ylsulfanyl)purin-6-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 23081895 |
| Molecular Formula | C19H20F3N7O3S2 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.10 |
| IUPAC Name | 7-but-2-ynyl-1-methyl-8-piperazin-1-yl-2-(1,3-thiazol-2-ylsulfanyl)purin-6-one;2,2,2-trifluoroacetic acid |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(Sc3nccs3)n(C)c(=O)c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H19N7OS2.C2HF3O2/c1-3-4-8-24-12-13(20-15(24)23-9-5-18-6-10-23)21-16(22(2)14(12)25)27-17-19-7-11-26-17;3-2(4,5)1(6)7/h7,11,18H,5-6,8-10H2,1-2H3;(H,6,7) |
| InChIKey | KDFCOKOCQVUHIM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 118.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|