C12H8F4O3S — CID 23082513
1,1,2,2-tetrafluoro-2-naphthalen-2-ylethanesulfonic acid (PubChem CID 23082513) has the molecular formula C12H8F4O3S and a molecular weight of 308.25 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-naphthalen-2-ylethanesulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-2-naphthalen-2-ylethanesulfonic acid |
|---|---|
| PubChem CID | 23082513 |
| Molecular Formula | C12H8F4O3S |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-naphthalen-2-ylethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H8F4O3S/c13-11(14,12(15,16)20(17,18)19)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H,(H,17,18,19) |
| InChIKey | BBCCXPWJPRBIPK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|