About 7-methyl-2,3-dihydro-1H-inden-1-ol
7-methyl-2,3-dihydro-1H-inden-1-ol (PubChem CID 23082867) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 7-methyl-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 7-methyl-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 23082867 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 7-methyl-2,3-dihydro-1H-inden-1-ol |
| SMILES | Cc1cccc2c1C(O)CC2 |
| InChI | InChI=1S/C10H12O/c1-7-3-2-4-8-5-6-9(11)10(7)8/h2-4,9,11H,5-6H2,1H3 |
| InChIKey | ULLMCWIDKZMYBU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methyl-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 7-methyl-2,3-dihydro-1H-inden-1-ol (CID 23082867) is 7-methyl-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 7-methyl-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 7-methyl-2,3-dihydro-1H-inden-1-ol is Cc1cccc2c1C(O)CC2.
What is the InChIKey of 7-methyl-2,3-dihydro-1H-inden-1-ol?
The InChIKey is ULLMCWIDKZMYBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c1-7-3-2-4-8-5-6-9(11)10(7)8/h2-4,9,11H,5-6H2,1H3.
What are the key properties of 7-methyl-2,3-dihydro-1H-inden-1-ol?
7-methyl-2,3-dihydro-1H-inden-1-ol has a molecular weight of 148.20 g/mol, XLogP of 1.97, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 23082867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).