C24H24O4 — CID 23083190
3-[4-[[3-(2,6-dimethylphenoxy)phenyl]methoxy]phenyl]propanoic acid (PubChem CID 23083190) has the molecular formula C24H24O4 and a molecular weight of 376.45 g/mol. Its IUPAC name is 3-[4-[[3-(2,6-dimethylphenoxy)phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[[3-(2,6-dimethylphenoxy)phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 23083190 |
| Molecular Formula | C24H24O4 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 3-[4-[[3-(2,6-dimethylphenoxy)phenyl]methoxy]phenyl]propanoic acid |
| SMILES | Cc1cccc(C)c1Oc1cccc(COc2ccc(CCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C24H24O4/c1-17-5-3-6-18(2)24(17)28-22-8-4-7-20(15-22)16-27-21-12-9-19(10-13-21)11-14-23(25)26/h3-10,12-13,15H,11,14,16H2,1-2H3,(H,25,26) |
| InChIKey | LVEBWTURJCJOLX-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |