C10H8N2O — CID 23083446
2-ethoxybenzene-1,3-dicarbonitrile (PubChem CID 23083446) has the molecular formula C10H8N2O and a molecular weight of 172.19 g/mol. Its IUPAC name is 2-ethoxybenzene-1,3-dicarbonitrile.
| Compound Name | 2-ethoxybenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 23083446 |
| Molecular Formula | C10H8N2O |
| Molecular Weight | 172.19 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 2-ethoxybenzene-1,3-dicarbonitrile |
| SMILES | CCOc1c(C#N)cccc1C#N |
| InChI | InChI=1S/C10H8N2O/c1-2-13-10-8(6-11)4-3-5-9(10)7-12/h3-5H,2H2,1H3 |
| InChIKey | VEIOMICTZIYZQC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.19 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |