About 4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride
4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride (PubChem CID 23083525) has the molecular formula C14H18Cl2N2O
and a molecular weight of 301.22 g/mol. Its IUPAC name is 4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride.
Molecular Properties
| Compound Name | 4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride |
| PubChem CID | 23083525 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride |
| SMILES | CC(C)/N=C(\N)c1ccc(-c2ccco2)cc1.Cl.Cl |
| InChI | InChI=1S/C14H16N2O.2ClH/c1-10(2)16-14(15)12-7-5-11(6-8-12)13-4-3-9-17-13;;/h3-10H,1-2H3,(H2,15,16);2*1H |
| InChIKey | ZPNBSJIGLKVJIM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 51.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride?
The IUPAC name of 4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride (CID 23083525) is 4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride.
What is the SMILES notation for 4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride?
The canonical SMILES for 4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride is CC(C)/N=C(\N)c1ccc(-c2ccco2)cc1.Cl.Cl.
What is the InChIKey of 4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride?
The InChIKey is ZPNBSJIGLKVJIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O.2ClH/c1-10(2)16-14(15)12-7-5-11(6-8-12)13-4-3-9-17-13;;/h3-10H,1-2H3,(H2,15,16);2*1H.
What are the key properties of 4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride?
4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride has a molecular weight of 301.22 g/mol, XLogP of 3.90, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-yl)-N'-propan-2-ylbenzenecarboximidamide;dihydrochloride is sourced from PubChem (CID 23083525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).