About 6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one
6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one (PubChem CID 23084056) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one.
Molecular Properties
| Compound Name | 6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one |
| PubChem CID | 23084056 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one |
| SMILES | O=C1c2cncn2CC1C1CCNCC1 |
| InChI | InChI=1S/C11H15N3O/c15-11-9(8-1-3-12-4-2-8)6-14-7-13-5-10(11)14/h5,7-9,12H,1-4,6H2 |
| InChIKey | IKTQGZFIPMPWND-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one?
The IUPAC name of 6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one (CID 23084056) is 6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one.
What is the SMILES notation for 6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one?
The canonical SMILES for 6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one is O=C1c2cncn2CC1C1CCNCC1.
What is the InChIKey of 6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one?
The InChIKey is IKTQGZFIPMPWND-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O/c15-11-9(8-1-3-12-4-2-8)6-14-7-13-5-10(11)14/h5,7-9,12H,1-4,6H2.
What are the key properties of 6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one?
6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one has a molecular weight of 205.26 g/mol, XLogP of 0.70, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperidin-4-yl-5,6-dihydropyrrolo[1,2-c]imidazol-7-one is sourced from PubChem (CID 23084056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).