About 3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate
3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate (PubChem CID 2308468) has the molecular formula C14H6F3N2OS-
and a molecular weight of 307.28 g/mol. Its IUPAC name is 3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate.
Molecular Properties
| Compound Name | 3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate |
| PubChem CID | 2308468 |
| Molecular Formula | C14H6F3N2OS- |
| Molecular Weight | 307.28 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate |
| SMILES | N#Cc1cc(C(=O)C(F)(F)F)c(-c2ccccc2)nc1[S-] |
| InChI | InChI=1S/C14H7F3N2OS/c15-14(16,17)12(20)10-6-9(7-18)13(21)19-11(10)8-4-2-1-3-5-8/h1-6H,(H,19,21)/p-1 |
| InChIKey | UZQYJFPYOBMJAK-UHFFFAOYSA-M |
| XLogP | 3.27 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate?
The IUPAC name of 3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate (CID 2308468) is 3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate.
What is the SMILES notation for 3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate?
The canonical SMILES for 3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate is N#Cc1cc(C(=O)C(F)(F)F)c(-c2ccccc2)nc1[S-].
What is the InChIKey of 3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate?
The InChIKey is UZQYJFPYOBMJAK-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H7F3N2OS/c15-14(16,17)12(20)10-6-9(7-18)13(21)19-11(10)8-4-2-1-3-5-8/h1-6H,(H,19,21)/p-1.
What are the key properties of 3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate?
3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate has a molecular weight of 307.28 g/mol, XLogP of 3.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyano-6-phenyl-5-(2,2,2-trifluoroacetyl)pyridine-2-thiolate is sourced from PubChem (CID 2308468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).