About 3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one
3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one (PubChem CID 23084760) has the molecular formula C22H22N2O
and a molecular weight of 330.43 g/mol. Its IUPAC name is 3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one |
| PubChem CID | 23084760 |
| Molecular Formula | C22H22N2O |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one |
| SMILES | Cc1[nH]c(=O)c2ccccc2c1CN1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H22N2O/c1-16-21(19-9-5-6-10-20(19)22(25)23-16)15-24-13-11-18(12-14-24)17-7-3-2-4-8-17/h2-11H,12-15H2,1H3,(H,23,25) |
| InChIKey | IZEGGHBVFRJRGX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one?
The IUPAC name of 3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one (CID 23084760) is 3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one.
What is the SMILES notation for 3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one?
The canonical SMILES for 3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one is Cc1[nH]c(=O)c2ccccc2c1CN1CC=C(c2ccccc2)CC1.
What is the InChIKey of 3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one?
The InChIKey is IZEGGHBVFRJRGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O/c1-16-21(19-9-5-6-10-20(19)22(25)23-16)15-24-13-11-18(12-14-24)17-7-3-2-4-8-17/h2-11H,12-15H2,1H3,(H,23,25).
What are the key properties of 3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one?
3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one has a molecular weight of 330.43 g/mol, XLogP of 4.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-[(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)methyl]-2H-isoquinolin-1-one is sourced from PubChem (CID 23084760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).