C28H29FN2O3P+ — CID 2308626
N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine (PubChem CID 2308626) has the molecular formula C28H29FN2O3P+ and a molecular weight of 491.52 g/mol. Its IUPAC name is N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine.
| Compound Name | N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine |
|---|---|
| PubChem CID | 2308626 |
| Molecular Formula | C28H29FN2O3P+ |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]-4-oxo-2,6-diphenyl-1,4lambda5-oxaphosphinin-4-amine |
| SMILES | O=P1(NC[C@@H](c2ccc(F)cc2)[NH+]2CCOCC2)C=C(c2ccccc2)OC(c2ccccc2)=C1 |
| InChI | InChI=1S/C28H28FN2O3P/c29-25-13-11-22(12-14-25)26(31-15-17-33-18-16-31)19-30-35(32)20-27(23-7-3-1-4-8-23)34-28(21-35)24-9-5-2-6-10-24/h1-14,20-21,26H,15-19H2,(H,30,32)/p+1/t26-/m0/s1 |
| InChIKey | IHLJNWKWSDFNBK-SANMLTNESA-O |
| XLogP | 4.68 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|