C12H21NO — CID 23086456
2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenoxazine (PubChem CID 23086456) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenoxazine.
| Compound Name | 2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenoxazine |
|---|---|
| PubChem CID | 23086456 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2,3,4,4a,5a,6,7,8,9,9a,10,10a-dodecahydro-1H-phenoxazine |
| SMILES | C1CCC2OC3CCCCC3NC2C1 |
| InChI | InChI=1S/C12H21NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h9-13H,1-8H2 |
| InChIKey | FZAPDYSQLCFDBR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |