C15H13F3N2O — CID 23086717
3-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydrocinnolin-5-ol (PubChem CID 23086717) has the molecular formula C15H13F3N2O and a molecular weight of 294.28 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydrocinnolin-5-ol.
| Compound Name | 3-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydrocinnolin-5-ol |
|---|---|
| PubChem CID | 23086717 |
| Molecular Formula | C15H13F3N2O |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-[3-(trifluoromethyl)phenyl]-5,6,7,8-tetrahydrocinnolin-5-ol |
| SMILES | OC1CCCc2nnc(-c3cccc(C(F)(F)F)c3)cc21 |
| InChI | InChI=1S/C15H13F3N2O/c16-15(17,18)10-4-1-3-9(7-10)13-8-11-12(19-20-13)5-2-6-14(11)21/h1,3-4,7-8,14,21H,2,5-6H2 |
| InChIKey | FZUNOPQLVQMNTQ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |