C18H18F3NO — CID 23087188
2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-5-(trifluoromethyl)aniline (PubChem CID 23087188) has the molecular formula C18H18F3NO and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-5-(trifluoromethyl)aniline.
| Compound Name | 2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 23087188 |
| Molecular Formula | C18H18F3NO |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-(6-methoxy-1,2,3,4-tetrahydronaphthalen-2-yl)-5-(trifluoromethyl)aniline |
| SMILES | COc1ccc2c(c1)CCC(c1ccc(C(F)(F)F)cc1N)C2 |
| InChI | InChI=1S/C18H18F3NO/c1-23-15-6-4-11-8-13(3-2-12(11)9-15)16-7-5-14(10-17(16)22)18(19,20)21/h4-7,9-10,13H,2-3,8,22H2,1H3 |
| InChIKey | YEDCKEIXPSWWGA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|