C36H47FN2O3 — CID 23087199
6-[2-[[3-fluoro-4-[2-(2,2,6,6-tetramethylpiperidin-1-yl)ethoxy]phenyl]methyl-methylamino]-4-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 23087199) has the molecular formula C36H47FN2O3 and a molecular weight of 574.78 g/mol. Its IUPAC name is 6-[2-[[3-fluoro-4-[2-(2,2,6,6-tetramethylpiperidin-1-yl)ethoxy]phenyl]methyl-methylamino]-4-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 6-[2-[[3-fluoro-4-[2-(2,2,6,6-tetramethylpiperidin-1-yl)ethoxy]phenyl]methyl-methylamino]-4-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 23087199 |
| Molecular Formula | C36H47FN2O3 |
| Molecular Weight | 574.78 g/mol |
| Exact Mass | 574.36 |
| IUPAC Name | 6-[2-[[3-fluoro-4-[2-(2,2,6,6-tetramethylpiperidin-1-yl)ethoxy]phenyl]methyl-methylamino]-4-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1ccc(C2CCc3cc(O)ccc3C2)c(N(C)Cc2ccc(OCCN3C(C)(C)CCCC3(C)C)c(F)c2)c1 |
| InChI | InChI=1S/C36H47FN2O3/c1-35(2)16-7-17-36(3,4)39(35)18-19-42-34-15-8-25(20-32(34)37)24-38(5)33-23-30(41-6)13-14-31(33)28-10-9-27-22-29(40)12-11-26(27)21-28/h8,11-15,20,22-23,28,40H,7,9-10,16-19,21,24H2,1-6H3 |
| InChIKey | DXMWTVJDVFOLKP-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.78 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |