C14H21N7O2S — CID 23087901
N-[1-azido-4-(dimethylamino)-4-oxobutan-2-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 23087901) has the molecular formula C14H21N7O2S and a molecular weight of 351.44 g/mol. Its IUPAC name is N-[1-azido-4-(dimethylamino)-4-oxobutan-2-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[1-azido-4-(dimethylamino)-4-oxobutan-2-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 23087901 |
| Molecular Formula | C14H21N7O2S |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-[1-azido-4-(dimethylamino)-4-oxobutan-2-yl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN1CCc2nc(C(=O)NC(CN=[N+]=[N-])CC(=O)N(C)C)sc2C1 |
| InChI | InChI=1S/C14H21N7O2S/c1-20(2)12(22)6-9(7-16-19-15)17-13(23)14-18-10-4-5-21(3)8-11(10)24-14/h9H,4-8H2,1-3H3,(H,17,23) |
| InChIKey | FDUNNFMTDCRAAF-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|