C15H8F3N3O — CID 23088249
3,4,6-trifluoro-5-(4-methoxyanilino)benzene-1,2-dicarbonitrile (PubChem CID 23088249) has the molecular formula C15H8F3N3O and a molecular weight of 303.24 g/mol. Its IUPAC name is 3,4,6-trifluoro-5-(4-methoxyanilino)benzene-1,2-dicarbonitrile.
| Compound Name | 3,4,6-trifluoro-5-(4-methoxyanilino)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 23088249 |
| Molecular Formula | C15H8F3N3O |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 3,4,6-trifluoro-5-(4-methoxyanilino)benzene-1,2-dicarbonitrile |
| SMILES | COc1ccc(Nc2c(F)c(F)c(C#N)c(C#N)c2F)cc1 |
| InChI | InChI=1S/C15H8F3N3O/c1-22-9-4-2-8(3-5-9)21-15-13(17)11(7-20)10(6-19)12(16)14(15)18/h2-5,21H,1H3 |
| InChIKey | NRCLOERTJXCVJX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 68.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|