C16H18F3N3S — CID 23088261
4-[4-(diethylamino)butylsulfanyl]-3,5,6-trifluorobenzene-1,2-dicarbonitrile (PubChem CID 23088261) has the molecular formula C16H18F3N3S and a molecular weight of 341.40 g/mol. Its IUPAC name is 4-[4-(diethylamino)butylsulfanyl]-3,5,6-trifluorobenzene-1,2-dicarbonitrile.
| Compound Name | 4-[4-(diethylamino)butylsulfanyl]-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 23088261 |
| Molecular Formula | C16H18F3N3S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 4-[4-(diethylamino)butylsulfanyl]-3,5,6-trifluorobenzene-1,2-dicarbonitrile |
| SMILES | CCN(CC)CCCCSc1c(F)c(F)c(C#N)c(C#N)c1F |
| InChI | InChI=1S/C16H18F3N3S/c1-3-22(4-2)7-5-6-8-23-16-14(18)12(10-21)11(9-20)13(17)15(16)19/h3-8H2,1-2H3 |
| InChIKey | WNDDWTZFZASXFT-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|