About N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide
N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide (PubChem CID 23088762) has the molecular formula C5H5BrN2OS
and a molecular weight of 221.08 g/mol. Its IUPAC name is N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide.
Molecular Properties
| Compound Name | N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide |
| PubChem CID | 23088762 |
| Molecular Formula | C5H5BrN2OS |
| Molecular Weight | 221.08 g/mol |
| Exact Mass | 219.93 |
| IUPAC Name | N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide |
| SMILES | O=CNCc1ncc(Br)s1 |
| InChI | InChI=1S/C5H5BrN2OS/c6-4-1-8-5(10-4)2-7-3-9/h1,3H,2H2,(H,7,9) |
| InChIKey | KIYHSKGOEAGEDR-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.08 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide?
The IUPAC name of N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide (CID 23088762) is N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide.
What is the SMILES notation for N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide?
The canonical SMILES for N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide is O=CNCc1ncc(Br)s1.
What is the InChIKey of N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide?
The InChIKey is KIYHSKGOEAGEDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BrN2OS/c6-4-1-8-5(10-4)2-7-3-9/h1,3H,2H2,(H,7,9).
What are the key properties of N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide?
N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide has a molecular weight of 221.08 g/mol, XLogP of 1.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-bromo-1,3-thiazol-2-yl)methyl]formamide is sourced from PubChem (CID 23088762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).