C8H16N2 — CID 23088844
1,2,3,6-tetramethyl-2,4-dihydropyrimidine (PubChem CID 23088844) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 1,2,3,6-tetramethyl-2,4-dihydropyrimidine.
| Compound Name | 1,2,3,6-tetramethyl-2,4-dihydropyrimidine |
|---|---|
| PubChem CID | 23088844 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1,2,3,6-tetramethyl-2,4-dihydropyrimidine |
| SMILES | CC1=CCN(C)C(C)N1C |
| InChI | InChI=1S/C8H16N2/c1-7-5-6-9(3)8(2)10(7)4/h5,8H,6H2,1-4H3 |
| InChIKey | HZZZJWRCCWTBHD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |