C21H15F7O3S2 — CID 23088901
1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate;triphenylsulfanium (PubChem CID 23088901) has the molecular formula C21H15F7O3S2 and a molecular weight of 512.47 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 23088901 |
| Molecular Formula | C21H15F7O3S2 |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropane-1-sulfonate;triphenylsulfanium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)F.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C3HF7O3S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4-1(5,2(6,7)8)3(9,10)14(11,12)13/h1-15H;(H,11,12,13)/q+1;/p-1 |
| InChIKey | GZMIOQRSCFVRFY-UHFFFAOYSA-M |
| XLogP | 6.10 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|