About oxolane-2,5-dione;trimethoxy(propyl)silane
oxolane-2,5-dione;trimethoxy(propyl)silane (PubChem CID 23089000) has the molecular formula C10H20O6Si
and a molecular weight of 264.35 g/mol. Its IUPAC name is oxolane-2,5-dione;trimethoxy(propyl)silane.
Molecular Properties
| Compound Name | oxolane-2,5-dione;trimethoxy(propyl)silane |
| PubChem CID | 23089000 |
| Molecular Formula | C10H20O6Si |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | oxolane-2,5-dione;trimethoxy(propyl)silane |
| SMILES | CCC[Si](OC)(OC)OC.O=C1CCC(=O)O1 |
| InChI | InChI=1S/C6H16O3Si.C4H4O3/c1-5-6-10(7-2,8-3)9-4;5-3-1-2-4(6)7-3/h5-6H2,1-4H3;1-2H2 |
| InChIKey | SCHFLJTVVICPLC-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze oxolane-2,5-dione;trimethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxolane-2,5-dione;trimethoxy(propyl)silane?
The IUPAC name of oxolane-2,5-dione;trimethoxy(propyl)silane (CID 23089000) is oxolane-2,5-dione;trimethoxy(propyl)silane.
What is the SMILES notation for oxolane-2,5-dione;trimethoxy(propyl)silane?
The canonical SMILES for oxolane-2,5-dione;trimethoxy(propyl)silane is CCC[Si](OC)(OC)OC.O=C1CCC(=O)O1.
What is the InChIKey of oxolane-2,5-dione;trimethoxy(propyl)silane?
The InChIKey is SCHFLJTVVICPLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16O3Si.C4H4O3/c1-5-6-10(7-2,8-3)9-4;5-3-1-2-4(6)7-3/h5-6H2,1-4H3;1-2H2.
What are the key properties of oxolane-2,5-dione;trimethoxy(propyl)silane?
oxolane-2,5-dione;trimethoxy(propyl)silane has a molecular weight of 264.35 g/mol, XLogP of 1.12, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for oxolane-2,5-dione;trimethoxy(propyl)silane is sourced from PubChem (CID 23089000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).