About 2-(diazinan-4-yl)-N,N-dimethylethanamine
2-(diazinan-4-yl)-N,N-dimethylethanamine (PubChem CID 23090108) has the molecular formula C8H19N3
and a molecular weight of 157.26 g/mol. Its IUPAC name is 2-(diazinan-4-yl)-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-(diazinan-4-yl)-N,N-dimethylethanamine |
| PubChem CID | 23090108 |
| Molecular Formula | C8H19N3 |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.16 |
| IUPAC Name | 2-(diazinan-4-yl)-N,N-dimethylethanamine |
| SMILES | CN(C)CCC1CCNNC1 |
| InChI | InChI=1S/C8H19N3/c1-11(2)6-4-8-3-5-9-10-7-8/h8-10H,3-7H2,1-2H3 |
| InChIKey | UOXYEXYOGHCGHY-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diazinan-4-yl)-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diazinan-4-yl)-N,N-dimethylethanamine?
The IUPAC name of 2-(diazinan-4-yl)-N,N-dimethylethanamine (CID 23090108) is 2-(diazinan-4-yl)-N,N-dimethylethanamine.
What is the SMILES notation for 2-(diazinan-4-yl)-N,N-dimethylethanamine?
The canonical SMILES for 2-(diazinan-4-yl)-N,N-dimethylethanamine is CN(C)CCC1CCNNC1.
What is the InChIKey of 2-(diazinan-4-yl)-N,N-dimethylethanamine?
The InChIKey is UOXYEXYOGHCGHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N3/c1-11(2)6-4-8-3-5-9-10-7-8/h8-10H,3-7H2,1-2H3.
What are the key properties of 2-(diazinan-4-yl)-N,N-dimethylethanamine?
2-(diazinan-4-yl)-N,N-dimethylethanamine has a molecular weight of 157.26 g/mol, XLogP of 0.05, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diazinan-4-yl)-N,N-dimethylethanamine is sourced from PubChem (CID 23090108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).