C8H16N2O2 — CID 23090340
methyl 2-(1,4-diazepan-5-yl)acetate (PubChem CID 23090340) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is methyl 2-(1,4-diazepan-5-yl)acetate.
| Compound Name | methyl 2-(1,4-diazepan-5-yl)acetate |
|---|---|
| PubChem CID | 23090340 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | methyl 2-(1,4-diazepan-5-yl)acetate |
| SMILES | COC(=O)CC1CCNCCN1 |
| InChI | InChI=1S/C8H16N2O2/c1-12-8(11)6-7-2-3-9-4-5-10-7/h7,9-10H,2-6H2,1H3 |
| InChIKey | AHEQJNABDLQZBI-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |