trimethyl(trifluoromethyl)azanium hydroxide

C4H10F3NO — CID 23090660

IUPACtrimethyl(trifluoromethyl)azanium hydroxide
SMILESC[N+](C)(C)C(F)(F)F.[OH-]
InChIInChI=1S/C4H9F3N.H2O/c1-8(2,3)4(5,6)7;/h1-3H3;1H2/q+1;/p-1
InChIKeyPJFUHWXVVOGWQY-UHFFFAOYSA-M
MW145.12 g/mol
LogP1.04
Rot. Bonds

About trimethyl(trifluoromethyl)azanium hydroxide

trimethyl(trifluoromethyl)azanium hydroxide (PubChem CID 23090660) has the molecular formula C4H10F3NO and a molecular weight of 145.12 g/mol. Its IUPAC name is trimethyl(trifluoromethyl)azanium hydroxide.

Molecular Properties

Compound Nametrimethyl(trifluoromethyl)azanium hydroxide
PubChem CID23090660
Molecular FormulaC4H10F3NO
Molecular Weight145.12 g/mol
Exact Mass145.07
IUPAC Nametrimethyl(trifluoromethyl)azanium hydroxide
SMILESC[N+](C)(C)C(F)(F)F.[OH-]
InChIInChI=1S/C4H9F3N.H2O/c1-8(2,3)4(5,6)7;/h1-3H3;1H2/q+1;/p-1
InChIKeyPJFUHWXVVOGWQY-UHFFFAOYSA-M
XLogP1.04
TPSA30.00 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.12
LogP ≤ 51.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}

Analyze trimethyl(trifluoromethyl)azanium hydroxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trimethyl(trifluoromethyl)azanium hydroxide?
The IUPAC name of trimethyl(trifluoromethyl)azanium hydroxide (CID 23090660) is trimethyl(trifluoromethyl)azanium hydroxide.
What is the SMILES notation for trimethyl(trifluoromethyl)azanium hydroxide?
The canonical SMILES for trimethyl(trifluoromethyl)azanium hydroxide is C[N+](C)(C)C(F)(F)F.[OH-].
What is the InChIKey of trimethyl(trifluoromethyl)azanium hydroxide?
The InChIKey is PJFUHWXVVOGWQY-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9F3N.H2O/c1-8(2,3)4(5,6)7;/h1-3H3;1H2/q+1;/p-1.
What are the key properties of trimethyl(trifluoromethyl)azanium hydroxide?
trimethyl(trifluoromethyl)azanium hydroxide has a molecular weight of 145.12 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trimethyl(trifluoromethyl)azanium hydroxide is sourced from PubChem (CID 23090660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).