C26H25NO — CID 23091392
2-amino-1,1-bis(4-methylphenyl)-2-naphthalen-1-ylethanol (PubChem CID 23091392) has the molecular formula C26H25NO and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-amino-1,1-bis(4-methylphenyl)-2-naphthalen-1-ylethanol.
| Compound Name | 2-amino-1,1-bis(4-methylphenyl)-2-naphthalen-1-ylethanol |
|---|---|
| PubChem CID | 23091392 |
| Molecular Formula | C26H25NO |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-amino-1,1-bis(4-methylphenyl)-2-naphthalen-1-ylethanol |
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)C(N)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C26H25NO/c1-18-10-14-21(15-11-18)26(28,22-16-12-19(2)13-17-22)25(27)24-9-5-7-20-6-3-4-8-23(20)24/h3-17,25,28H,27H2,1-2H3 |
| InChIKey | XAQMHFUQNNXRRY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |