C8H15NO2 — CID 23091622
N,N-dimethyloxane-4-carboxamide (PubChem CID 23091622) has the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. Its IUPAC name is N,N-dimethyloxane-4-carboxamide.
| Compound Name | N,N-dimethyloxane-4-carboxamide |
|---|---|
| PubChem CID | 23091622 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | N,N-dimethyloxane-4-carboxamide |
| SMILES | CN(C)C(=O)C1CCOCC1 |
| InChI | InChI=1S/C8H15NO2/c1-9(2)8(10)7-3-5-11-6-4-7/h7H,3-6H2,1-2H3 |
| InChIKey | SKBXXZBWCIRDFH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |