About 1-(3-chloropropyl)-2,2-dimethylpyrrolidine
1-(3-chloropropyl)-2,2-dimethylpyrrolidine (PubChem CID 23091634) has the molecular formula C9H18ClN
and a molecular weight of 175.70 g/mol. Its IUPAC name is 1-(3-chloropropyl)-2,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 1-(3-chloropropyl)-2,2-dimethylpyrrolidine |
| PubChem CID | 23091634 |
| Molecular Formula | C9H18ClN |
| Molecular Weight | 175.70 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 1-(3-chloropropyl)-2,2-dimethylpyrrolidine |
| SMILES | CC1(C)CCCN1CCCCl |
| InChI | InChI=1S/C9H18ClN/c1-9(2)5-3-7-11(9)8-4-6-10/h3-8H2,1-2H3 |
| InChIKey | UPILWEJDBYSLHW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.70 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloropropyl)-2,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloropropyl)-2,2-dimethylpyrrolidine?
The IUPAC name of 1-(3-chloropropyl)-2,2-dimethylpyrrolidine (CID 23091634) is 1-(3-chloropropyl)-2,2-dimethylpyrrolidine.
What is the SMILES notation for 1-(3-chloropropyl)-2,2-dimethylpyrrolidine?
The canonical SMILES for 1-(3-chloropropyl)-2,2-dimethylpyrrolidine is CC1(C)CCCN1CCCCl.
What is the InChIKey of 1-(3-chloropropyl)-2,2-dimethylpyrrolidine?
The InChIKey is UPILWEJDBYSLHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18ClN/c1-9(2)5-3-7-11(9)8-4-6-10/h3-8H2,1-2H3.
What are the key properties of 1-(3-chloropropyl)-2,2-dimethylpyrrolidine?
1-(3-chloropropyl)-2,2-dimethylpyrrolidine has a molecular weight of 175.70 g/mol, XLogP of 2.49, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloropropyl)-2,2-dimethylpyrrolidine is sourced from PubChem (CID 23091634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).