About methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate
methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate (PubChem CID 23091726) has the molecular formula C15H19BrN2O2
and a molecular weight of 339.23 g/mol. Its IUPAC name is methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate.
Molecular Properties
| Compound Name | methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate |
| PubChem CID | 23091726 |
| Molecular Formula | C15H19BrN2O2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate |
| SMILES | CCCN1CCC/C(C(=O)OC)=C\c2cc(Br)cnc21 |
| InChI | InChI=1S/C15H19BrN2O2/c1-3-6-18-7-4-5-11(15(19)20-2)8-12-9-13(16)10-17-14(12)18/h8-10H,3-7H2,1-2H3/b11-8+ |
| InChIKey | YBPTZPUMWMNYPW-DHZHZOJOSA-N |
| XLogP | 3.41 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate?
The IUPAC name of methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate (CID 23091726) is methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate.
What is the SMILES notation for methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate?
The canonical SMILES for methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate is CCCN1CCC/C(C(=O)OC)=C\c2cc(Br)cnc21.
What is the InChIKey of methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate?
The InChIKey is YBPTZPUMWMNYPW-DHZHZOJOSA-N. The full InChI is InChI=1S/C15H19BrN2O2/c1-3-6-18-7-4-5-11(15(19)20-2)8-12-9-13(16)10-17-14(12)18/h8-10H,3-7H2,1-2H3/b11-8+.
What are the key properties of methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate?
methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate has a molecular weight of 339.23 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (5E)-3-bromo-10-propyl-8,9-dihydro-7H-pyrido[2,3-b]azocine-6-carboxylate is sourced from PubChem (CID 23091726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).