C10H8F6N2O4 — CID 23092420
6-methyl-3-nitro-2,4-bis(2,2,2-trifluoroethoxy)pyridine (PubChem CID 23092420) has the molecular formula C10H8F6N2O4 and a molecular weight of 334.17 g/mol. Its IUPAC name is 6-methyl-3-nitro-2,4-bis(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 6-methyl-3-nitro-2,4-bis(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 23092420 |
| Molecular Formula | C10H8F6N2O4 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 6-methyl-3-nitro-2,4-bis(2,2,2-trifluoroethoxy)pyridine |
| SMILES | Cc1cc(OCC(F)(F)F)c([N+](=O)[O-])c(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H8F6N2O4/c1-5-2-6(21-3-9(11,12)13)7(18(19)20)8(17-5)22-4-10(14,15)16/h2H,3-4H2,1H3 |
| InChIKey | UWZOAJKKXKXEKU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|