About [(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane
[(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane (PubChem CID 23092750) has the molecular formula C16H34O2Si2
and a molecular weight of 314.62 g/mol. Its IUPAC name is [(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane |
| PubChem CID | 23092750 |
| Molecular Formula | C16H34O2Si2 |
| Molecular Weight | 314.62 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | [(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane |
| SMILES | C/C1=C/CCC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C16H34O2Si2/c1-13-10-9-11-14(2)16(18-20(6,7)8)15(12-13)17-19(3,4)5/h10,14-16H,9,11-12H2,1-8H3/b13-10- |
| InChIKey | WUOHAAXAXDXVAT-RAXLEYEMSA-N |
| XLogP | 5.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane?
The IUPAC name of [(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane (CID 23092750) is [(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane.
What is the SMILES notation for [(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane?
The canonical SMILES for [(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane is C/C1=C/CCC(C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1.
What is the InChIKey of [(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane?
The InChIKey is WUOHAAXAXDXVAT-RAXLEYEMSA-N. The full InChI is InChI=1S/C16H34O2Si2/c1-13-10-9-11-14(2)16(18-20(6,7)8)15(12-13)17-19(3,4)5/h10,14-16H,9,11-12H2,1-8H3/b13-10-.
What are the key properties of [(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane?
[(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane has a molecular weight of 314.62 g/mol, XLogP of 5.19, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3Z)-3,7-dimethyl-8-trimethylsilyloxycyclooct-3-en-1-yl]oxy-trimethylsilane is sourced from PubChem (CID 23092750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).