About [(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane
[(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane (PubChem CID 23092765) has the molecular formula C13H26OSi
and a molecular weight of 226.44 g/mol. Its IUPAC name is [(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane |
| PubChem CID | 23092765 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | [(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane |
| SMILES | C/C1=C/CCC(O[Si](C)(C)C)C(C)CC1 |
| InChI | InChI=1S/C13H26OSi/c1-11-7-6-8-13(12(2)10-9-11)14-15(3,4)5/h7,12-13H,6,8-10H2,1-5H3/b11-7- |
| InChIKey | YKAGSVCVWQVEAG-XFFZJAGNSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane?
The IUPAC name of [(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane (CID 23092765) is [(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane.
What is the SMILES notation for [(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane?
The canonical SMILES for [(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane is C/C1=C/CCC(O[Si](C)(C)C)C(C)CC1.
What is the InChIKey of [(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane?
The InChIKey is YKAGSVCVWQVEAG-XFFZJAGNSA-N. The full InChI is InChI=1S/C13H26OSi/c1-11-7-6-8-13(12(2)10-9-11)14-15(3,4)5/h7,12-13H,6,8-10H2,1-5H3/b11-7-.
What are the key properties of [(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane?
[(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane has a molecular weight of 226.44 g/mol, XLogP of 4.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(4Z)-5,8-dimethylcyclooct-4-en-1-yl]oxy-trimethylsilane is sourced from PubChem (CID 23092765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).