C14H22O6 — CID 23092801
[(4Z)-8-methoxycarbonyloxy-1,5-dimethylcyclooct-4-en-1-yl] methyl carbonate (PubChem CID 23092801) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is [(4Z)-8-methoxycarbonyloxy-1,5-dimethylcyclooct-4-en-1-yl] methyl carbonate.
| Compound Name | [(4Z)-8-methoxycarbonyloxy-1,5-dimethylcyclooct-4-en-1-yl] methyl carbonate |
|---|---|
| PubChem CID | 23092801 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [(4Z)-8-methoxycarbonyloxy-1,5-dimethylcyclooct-4-en-1-yl] methyl carbonate |
| SMILES | COC(=O)OC1CC/C(C)=C\CCC1(C)OC(=O)OC |
| InChI | InChI=1S/C14H22O6/c1-10-6-5-9-14(2,20-13(16)18-4)11(8-7-10)19-12(15)17-3/h6,11H,5,7-9H2,1-4H3/b10-6- |
| InChIKey | WZSOPZOFTPVCLK-POHAHGRESA-N |
| XLogP | 3.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|